EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O4 |
| Net Charge | 0 |
| Average Mass | 274.316 |
| Monoisotopic Mass | 274.12051 |
| SMILES | [H][C@@]1(C(=C)C(=O)OC)CC2=C(C)C(=O)OC2=C[C@@]1(C)C=C |
| InChI | InChI=1S/C16H18O4/c1-6-16(4)8-13-11(9(2)15(18)20-13)7-12(16)10(3)14(17)19-5/h6,8,12H,1,3,7H2,2,4-5H3/t12-,16+/m0/s1 |
| InChIKey | JVYKKRDPTBBMIB-BLLLJJGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hiiranlactone C (CHEBI:69078) has role metabolite (CHEBI:25212) |
| hiiranlactone C (CHEBI:69078) is a benzofurans (CHEBI:35259) |
| Citations |
|---|