EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28O |
| Net Charge | 0 |
| Average Mass | 236.399 |
| Monoisotopic Mass | 236.21402 |
| SMILES | [H][C@]12[C@H](C(C)C)CC[C@@H](C)[C@]13CC[C@@](C)(OC)[C@]23[H] |
| InChI | InChI=1S/C16H28O/c1-10(2)12-7-6-11(3)16-9-8-15(4,17-5)14(16)13(12)16/h10-14H,6-9H2,1-5H3/t11-,12+,13-,14+,15-,16-/m1/s1 |
| InChIKey | KGDMYCGPRNMUSW-ZTYXSZCMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epicubebol methyl ether (CHEBI:69077) has role metabolite (CHEBI:25212) |
| epicubebol methyl ether (CHEBI:69077) is a sesquiterpenoid (CHEBI:26658) |
| Citations |
|---|