EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O4 |
| Net Charge | 0 |
| Average Mass | 260.289 |
| Monoisotopic Mass | 260.10486 |
| SMILES | [H][C@@]12C=C(CC[C@]3([H])O[C@@]3(C)Cc3occ(C)c31)C(=O)O2 |
| InChI | InChI=1S/C15H16O4/c1-8-7-17-11-6-15(2)12(19-15)4-3-9-5-10(13(8)11)18-14(9)16/h5,7,10,12H,3-4,6H2,1-2H3/t10-,12+,15+/m1/s1 |
| InChIKey | NJMLHRWYACXVHJ-GMXABZIVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pseudoneolinderane (CHEBI:69075) has role metabolite (CHEBI:25212) |
| pseudoneolinderane (CHEBI:69075) is a butenolide (CHEBI:50523) |
| Synonym | Source |
|---|---|
| 5H-7,4-Methenofuro(3,2-c)oxireno(f)oxacycloundecin-5-one,1a,2,3,7,11,11a-hexahydro-8,11a-dimethyl-, (1aS,7R,11aS)- | ChEBI |
| Citations |
|---|