EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O3 |
| Net Charge | 0 |
| Average Mass | 244.290 |
| Monoisotopic Mass | 244.10994 |
| SMILES | [H][C@]12C(=C)C(=O)O[C@@]1([H])c1c(C)coc1C[C@]2(C)C=C |
| InChI | InChI=1S/C15H16O3/c1-5-15(4)6-10-11(8(2)7-17-10)13-12(15)9(3)14(16)18-13/h5,7,12-13H,1,3,6H2,2,4H3/t12-,13-,15-/m0/s1 |
| InChIKey | VXZIFOKTSURLNL-YDHLFZDLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isolinderalactone (CHEBI:69073) has role metabolite (CHEBI:25212) |
| isolinderalactone (CHEBI:69073) is a benzofurans (CHEBI:35259) |
| Synonym | Source |
|---|---|
| (3aS,4R,8bR)-4-ethenyl-4,8-dimethyl-3-methylidene-5,8b-dihydro-3aH-furo[2,3-e][1]benzofuran-2-one | ChEBI |
| Citations |
|---|