EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O5 |
| Net Charge | 0 |
| Average Mass | 276.288 |
| Monoisotopic Mass | 276.09977 |
| SMILES | [H][C@@]12C=C(CC[C@@]3([H])O[C@]3(C)Cc3occ(CO)c31)C(=O)O2 |
| InChI | InChI=1S/C15H16O5/c1-15-5-11-13(9(6-16)7-18-11)10-4-8(14(17)19-10)2-3-12(15)20-15/h4,7,10,12,16H,2-3,5-6H2,1H3/t10-,12-,15-/m1/s1 |
| InChIKey | ZPKVSOBSXNUENY-IXPVHAAZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daibulactone B, (rel)- (CHEBI:69071) has role metabolite (CHEBI:25212) |
| daibulactone B, (rel)- (CHEBI:69071) is a butenolide (CHEBI:50523) |
| Citations |
|---|