EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O5 |
| Net Charge | 0 |
| Average Mass | 302.326 |
| Monoisotopic Mass | 302.11542 |
| SMILES | [H][C@@]12C=C(C[C@@H](OC(C)=O)/C=C(\C)Cc3occ(C)c31)C(=O)O2 |
| InChI | InChI=1S/C17H18O5/c1-9-4-13(21-11(3)18)6-12-7-15(22-17(12)19)16-10(2)8-20-14(16)5-9/h4,7-8,13,15H,5-6H2,1-3H3/b9-4+/t13-,15+/m0/s1 |
| InChIKey | IAFGRUKVDHTZPP-MXXQPQJVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daibulactone A, (rel)- (CHEBI:69070) has role metabolite (CHEBI:25212) |
| daibulactone A, (rel)- (CHEBI:69070) is a butenolide (CHEBI:50523) |
| Synonym | Source |
|---|---|
| 3-acetoxylinderalactone | ChEBI |
| Citations |
|---|