EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13ClN2O2 |
| Net Charge | 0 |
| Average Mass | 228.679 |
| Monoisotopic Mass | 228.06656 |
| SMILES | COc1ccc(NC(=O)N(C)C)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O2/c1-13(2)10(14)12-7-4-5-9(15-3)8(11)6-7/h4-6H,1-3H3,(H,12,14) |
| InChIKey | DSRNRYQBBJQVCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metoxuron (CHEBI:6907) has role agrochemical (CHEBI:33286) |
| metoxuron (CHEBI:6907) has role environmental contaminant (CHEBI:78298) |
| metoxuron (CHEBI:6907) has role herbicide (CHEBI:24527) |
| metoxuron (CHEBI:6907) has role photosystem-II inhibitor (CHEBI:26089) |
| metoxuron (CHEBI:6907) has role plant growth regulator (CHEBI:26155) |
| metoxuron (CHEBI:6907) has role xenobiotic (CHEBI:35703) |
| metoxuron (CHEBI:6907) is a 3-(3,4-substituted-phenyl)-1,1-dimethylurea (CHEBI:157693) |
| metoxuron (CHEBI:6907) is a monochlorobenzenes (CHEBI:83403) |
| metoxuron (CHEBI:6907) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea |
| Synonyms | Source |
|---|---|
| (3-chloro-4-methoxyphenyl)-N,N-dimethylurea | ChemIDplus |
| N'-(3-chloro-4-methoxyphenyl)-N,N-dimethylurea | IUPAC |
| N-(3-chloro-4-methoxyphenyl)-N',N'-dimethylurea | ChemIDplus |
| N,N-dimethyl-N'-(4-methoxy-3-chlorophenyl)urea | ChemIDplus |
| herbicide 6602 | ChemIDplus |
| SAN 6915H | PPDB |
| Brand Names | Source |
|---|---|
| Deftor | ChemIDplus |
| Dosaflo | ChemIDplus |
| Dosagran | ChemIDplus |
| Dosanex | KEGG COMPOUND |
| Investt | ChEBI |
| Purivel | ChemIDplus |
| UniProt Name | Source |
|---|---|
| metoxuron | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2128284 | Reaxys |
| CAS:19937-59-8 | NIST Chemistry WebBook |
| CAS:19937-59-8 | ChemIDplus |
| Citations |
|---|