EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17N3O5S2 |
| Net Charge | 0 |
| Average Mass | 383.451 |
| Monoisotopic Mass | 383.06096 |
| SMILES | CS[C@@]1(CO)C(=O)N2c3cc([N+](=O)[O-])ccc3C[C@]2(SC)C(=O)N1C |
| InChI | InChI=1S/C15H17N3O5S2/c1-16-12(20)14(24-2)7-9-4-5-10(18(22)23)6-11(9)17(14)13(21)15(16,8-19)25-3/h4-6,19H,7-8H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | QPNKLYVDVCPJLD-GJZGRUSLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sphingomonas sp. (ncbitaxon:28214) | - | PubMed (21954885) | Coculture of Sphingomonas sp.(KMK-001) and Aspergillus fumigatus(KMC-901),ethyl acetate extract. Strain: KMK-001 |
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (21954885) | Coculture of Sphingomonas sp.(KMK-001) and Aspergillus fumigatus(KMC-901),ethyl acetate extract. Strain: KMC 901 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glionitrin B (CHEBI:69064) has role Aspergillus metabolite (CHEBI:76956) |
| Glionitrin B (CHEBI:69064) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonyms | Source |
|---|---|
| 3S,10aS-dithiomethylglionitrin A | ChEBI |
| (3S,10aS)-3-(hydroxymethyl)-2-methyl-3,10a-bis(methylsulfanyl)-7-nitro-10H-pyrazino[1,2-a]indole-1,4-dione | ChEBI |
| Citations |
|---|