EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N5O |
| Net Charge | 0 |
| Average Mass | 193.210 |
| Monoisotopic Mass | 193.09636 |
| SMILES | Cn1c(=N)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C8H11N5O/c1-11-4-10-7-5(11)6(9)12(2)8(14)13(7)3/h4,9H,1-3H3 |
| InChIKey | WESYAFXNPBDJQH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paramuricea clavata (ncbitaxon:317549) | - | PubMed (21939218) | CH2Cl2:MeOH(1:1) extract of lyophilized material |
| Pseudodistoma cereum (WORMS:251218) | - | PubMed (21939218) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,7-trimethylisoguanine (CHEBI:69063) has role metabolite (CHEBI:25212) |
| 1,3,7-trimethylisoguanine (CHEBI:69063) is a oxopurine (CHEBI:25810) |
| Synonym | Source |
|---|---|
| 6-Imino-1,3,7-trimethyl-1,3,6,7-tetrahydro-2H-purin-2-one | ChEBI |
| Citations |
|---|