EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N5O |
| Net Charge | 0 |
| Average Mass | 179.183 |
| Monoisotopic Mass | 179.08071 |
| SMILES | Cn1cnc2c1c(N)nc(=O)n2C |
| InChI | InChI=1S/C7H9N5O/c1-11-3-9-6-4(11)5(8)10-7(13)12(6)2/h3H,1-2H3,(H2,8,10,13) |
| InChIKey | JZQHSYUUSIOKEV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paramuricea clavata (ncbitaxon:317549) | - | PubMed (21939218) | CH2Cl2:MeOH(1:1) extract of lyophilized material |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,7-dimethylisoguanine (CHEBI:69062) has role metabolite (CHEBI:25212) |
| 3,7-dimethylisoguanine (CHEBI:69062) is a oxopurine (CHEBI:25810) |
| Synonym | Source |
|---|---|
| 6-amino-3,7-dimethyl-3,7-dihydro-2H-purin-2-one | ChEBI |
| Citations |
|---|