EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO2 |
| Net Charge | 0 |
| Average Mass | 137.138 |
| Monoisotopic Mass | 137.04768 |
| SMILES | C[n+]1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C7H7NO2/c1-8-5-3-2-4-6(8)7(9)10/h2-5H,1H3 |
| InChIKey | BRTLKRNVNFIOPJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cucumaria georgiana (ncbitaxon:864626) | - | MetaboLights (MTBLS336) | |
| Paramuricea clavata (ncbitaxon:317549) | - | PubMed (21939218) | CH2Cl2:MeOH(1:1) extract of lyophilized material |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Betaine homarine (CHEBI:69061) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonyms | Source |
|---|---|
| 1-methylpyridinium-2-carboxylate | ChEBI |
| Homarine | ChEBI |
| n-methylpicolinic acid | ChEBI |
| Citations |
|---|