EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O |
| Net Charge | 0 |
| Average Mass | 188.230 |
| Monoisotopic Mass | 188.09496 |
| SMILES | Oc1ccc2nc3c(c2c1)CCNC3 |
| InChI | InChI=1S/C11H12N2O/c14-7-1-2-10-9(5-7)8-3-4-12-6-11(8)13-10/h1-2,5,12-14H,3-4,6H2 |
| InChIKey | HASNCBJLQYTILW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paramuricea clavata (ncbitaxon:317549) | - | PubMed (21939218) | CH2Cl2:MeOH(1:1) extract of lyophilized material |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Hydroxytetrahydro-beta-carboline (CHEBI:69060) has role metabolite (CHEBI:25212) |
| 6-Hydroxytetrahydro-beta-carboline (CHEBI:69060) is a β-carbolines (CHEBI:60834) |
| Synonyms | Source |
|---|---|
| 2,3,4,9-Tetrahydro-1H-pyrido(3,4-b)indol-6-ol | ChEBI |
| 5-Hydroxytryptoline | ChEBI |
| Plectocomine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 0023778349 | ChemIDplus |
| Citations |
|---|