EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C15H25NO3.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 684.824 |
| Monoisotopic Mass | 684.38333 |
| SMILES | COCCc1ccc(OCC(O)CNC(C)C)cc1.COCCc1ccc(OCC(O)CNC(C)C)cc1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/2C15H25NO3.C4H6O6/c2*1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3;5-1(3(7)8)2(6)4(9)10/h2*4-7,12,14,16-17H,8-11H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/t;;1-,2-/m..1/s1 |
| InChIKey | YGULWPYYGQCFMP-CEAXSRTFSA-N |
| Roles Classification |
|---|
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metoprolol tartrate (CHEBI:6906) has role anti-arrhythmia drug (CHEBI:38070) |
| Metoprolol tartrate (CHEBI:6906) has role antihypertensive agent (CHEBI:35674) |
| Metoprolol tartrate (CHEBI:6906) has role cardiovascular drug (CHEBI:35554) |
| Metoprolol tartrate (CHEBI:6906) is a alcohol (CHEBI:30879) |
| Metoprolol tartrate (CHEBI:6906) is a phenols (CHEBI:33853) |
| Synonyms | Source |
|---|---|
| Beloc | ChEMBL |
| CGP-2175E | ChEMBL |
| Lopressor (TN) | KEGG COMPOUND |
| Metoprolol hemitartrate | ChEMBL |
| Metoprolol tartrate | KEGG COMPOUND |
| Metropress | ChEMBL |
| Brand Names | Source |
|---|---|
| Arbralene | ChEMBL |
| Beloc cor | ChEMBL |
| Betaloc | ChEMBL |
| Betaloc s.a. | ChEMBL |
| Lopresor sr | ChEMBL |
| Mepranix 100 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00601 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:56392-17-7 | KEGG COMPOUND |
| Citations |
|---|