EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12BrNO |
| Net Charge | 0 |
| Average Mass | 230.105 |
| Monoisotopic Mass | 229.01023 |
| SMILES | CNCCc1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C9H12BrNO/c1-11-5-4-7-2-3-9(12)8(10)6-7/h2-3,6,11-12H,4-5H2,1H3 |
| InChIKey | AINJSQXLMHMVIX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paramuricea clavata (ncbitaxon:317549) | - | PubMed (21939218) | CH2Cl2:MeOH(1:1) extract of lyophilized material |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Bromo-N-methyltyramine (CHEBI:69058) has role metabolite (CHEBI:25212) |
| 3-Bromo-N-methyltyramine (CHEBI:69058) is a primary amine (CHEBI:32877) |
| Synonym | Source |
|---|---|
| 2-bromo-4-[2-(methylamino)ethyl]phenol | ChEBI |
| Citations |
|---|