EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31N |
| Net Charge | 0 |
| Average Mass | 297.486 |
| Monoisotopic Mass | 297.24565 |
| SMILES | [H][C@]12CCC(=C)[C@@]3([H])[C@H](C=C(C)C)C[C@H](C)[C@@]([H])(CC[C@]1(C)[N+]#[C-])[C@]23[H] |
| InChI | InChI=1S/C21H31N/c1-13(2)11-16-12-15(4)17-9-10-21(5,22-6)18-8-7-14(3)19(16)20(17)18/h11,15-20H,3,7-10,12H2,1-2,4-5H3/t15-,16+,17+,18+,19-,20+,21-/m0/s1 |
| InChIKey | YLUPPLFDZXAQDE-YMJVXHRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudaxinella flava (WORMS:165716) | - | PubMed (21985105) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,3S,3aR,6S,6aR,9aS,9bS)-6-isocyano-3,6-dimethyl-9-methylidene-1-(2-methylprop-1-enyl)-2,3,3a,4,5,6a,7,8,9a,9b-decahydro-1H-phenalene (CHEBI:69053) has role metabolite (CHEBI:25212) |
| (1S,3S,3aR,6S,6aR,9aS,9bS)-6-isocyano-3,6-dimethyl-9-methylidene-1-(2-methylprop-1-enyl)-2,3,3a,4,5,6a,7,8,9a,9b-decahydro-1H-phenalene (CHEBI:69053) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|