EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H56N10O12S6 |
| Net Charge | 0 |
| Average Mass | 1157.436 |
| Monoisotopic Mass | 1156.24034 |
| SMILES | CSC[C@@H]1C(=O)SC[C@H](NC(=O)c2nc3ccccc3cc2O)C(=O)NCC(=O)N(C)[C@@H]2CSSC[C@H](C(=O)N1C)N(C)C(=O)CNC(=O)[C@@H](NC(=O)c1nc3ccccc3cc1O)CSC(=O)[C@@H](CSC)N(C)C2=O |
| InChI | InChI=1S/C48H56N10O12S6/c1-55-31-23-75-76-24-32(46(68)58(4)34(22-72-6)48(70)74-19-29(41(63)49-17-37(55)61)53-43(65)39-35(59)15-25-11-7-9-13-27(25)51-39)56(2)38(62)18-50-42(64)30(20-73-47(69)33(21-71-5)57(3)45(31)67)54-44(66)40-36(60)16-26-12-8-10-14-28(26)52-40/h7-16,29-34,59-60H,17-24H2,1-6H3,(H,49,63)(H,50,64)(H,53,65)(H,54,66)/t29-,30-,31+,32+,33+,34+/m0/s1 |
| InChIKey | UPGGKUQISSWRJJ-XLTUSUNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Verrucosispeciesra (ncbitaxon:84593) | - | PubMed (21923106) | Isolated from the sponge Chondrilla caribensis f. caribensis(FLK-10-4-24) Strain: WMMA107 |
| Micromonospora marina (ncbitaxon:307120) | - | PubMed (21923106) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thiocoraline (CHEBI:69052) is a peptide (CHEBI:16670) |
| Synonym | Source |
|---|---|
| thiocoraline A | ChEBI |
| Citations |
|---|