EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22O4 |
| Net Charge | 0 |
| Average Mass | 254.326 |
| Monoisotopic Mass | 254.15181 |
| SMILES | [H][C@@]12C[C@]3(CC[C@@H]1O)C(C)(C)CCC(=O)[C@@]3(C)OO2 |
| InChI | InChI=1S/C14H22O4/c1-12(2)6-5-11(16)13(3)14(12)7-4-9(15)10(8-14)17-18-13/h9-10,15H,4-8H2,1-3H3/t9-,10+,13+,14+/m0/s1 |
| InChIKey | QYJVCFQEMCWLHS-GZZJDILISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Endophytic fungi (ncbitaxon:4751) | - | PubMed (21954864) | Ethyl acetate extract of endophytic fungus isolated from leaves of Xylocarpus granatum. Strain: XG8D |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Steperoxide A (CHEBI:69051) has role metabolite (CHEBI:25212) |
| Steperoxide A (CHEBI:69051) is a cyclohexanones (CHEBI:23482) |
| Citations |
|---|