EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C15H25NO3.C4H6O4 |
| Net Charge | 0 |
| Average Mass | 652.826 |
| Monoisotopic Mass | 652.39350 |
| SMILES | COCCc1ccc(OCC(O)CNC(C)C)cc1.COCCc1ccc(OCC(O)CNC(C)C)cc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/2C15H25NO3.C4H6O4/c2*1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3;5-3(6)1-2-4(7)8/h2*4-7,12,14,16-17H,8-11H2,1-3H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | RGHAZVBIOOEVQX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metoprolol succinate (CHEBI:6905) has role anti-arrhythmia drug (CHEBI:38070) |
| Metoprolol succinate (CHEBI:6905) has role antihypertensive agent (CHEBI:35674) |
| Metoprolol succinate (CHEBI:6905) has role cardiovascular drug (CHEBI:35554) |
| Metoprolol succinate (CHEBI:6905) has role renoprotective agent (CHEBI:231911) |
| Metoprolol succinate (CHEBI:6905) is a alcohol (CHEBI:30879) |
| Metoprolol succinate (CHEBI:6905) is a phenols (CHEBI:33853) |
| Synonyms | Source |
|---|---|
| H 93/26 SUCCINATE | ChEMBL |
| Metoprolol hemisuccinate | ChEMBL |
| Metoprolol succinate | KEGG COMPOUND |
| Seloken-zok | ChEMBL |
| Selozok | ChEMBL |
| Toprol XL (TN) | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Kapspargo sprinkle | ChEMBL |
| Metoprolol succinate component of dutoprol | ChEMBL |
| Toprol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00635 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:98418-47-4 | KEGG COMPOUND |
| Citations |
|---|