EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O8 |
| Net Charge | 0 |
| Average Mass | 498.572 |
| Monoisotopic Mass | 498.22537 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@H](c4ccoc4)OC(=O)[C@@]4([H])O[C@@]34[C@]1(C)[C@H](OC(C)=O)C[C@@]1([H])C(C)(C)OC(=O)C=C[C@]21C |
| InChI | InChI=1S/C28H34O8/c1-15(29)33-19-13-18-24(2,3)35-20(30)8-10-25(18,4)17-7-11-26(5)21(16-9-12-32-14-16)34-23(31)22-28(26,36-22)27(17,19)6/h8-10,12,14,17-19,21-22H,7,11,13H2,1-6H3/t17-,18+,19-,21-,22-,25-,26+,27+,28-/m1/s1 |
| InChIKey | VGEVFODMPBFOHX-XJHXUBQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citropsis articulata (IPNI:771824-1) | root (BTO:0001188) | PubMed (21985060) | Previous component: root bark; Ethyl acetate extract of dried and powdered root bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7alpha-Obacunyl acetate (CHEBI:69046) has role metabolite (CHEBI:25212) |
| 7alpha-Obacunyl acetate (CHEBI:69046) is a limonoid (CHEBI:39434) |
| Citations |
|---|