EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17NO4 |
| Net Charge | 0 |
| Average Mass | 323.348 |
| Monoisotopic Mass | 323.11576 |
| SMILES | Cn1c2c(O)cccc2c(=O)c2c(O)cc3c(c21)C=CC(C)(C)O3 |
| InChI | InChI=1S/C19H17NO4/c1-19(2)8-7-10-14(24-19)9-13(22)15-17(10)20(3)16-11(18(15)23)5-4-6-12(16)21/h4-9,21-22H,1-3H3 |
| InChIKey | JZQDCDLYNFZBIG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citropsis articulata (IPNI:771824-1) | root (BTO:0001188) | PubMed (21985060) | Previous component: root bark; Methanol extract of dried, powdered root bark. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Hydroxynoracronycine (CHEBI:69044) has functional parent acridone (CHEBI:50756) |
| 5-Hydroxynoracronycine (CHEBI:69044) has role metabolite (CHEBI:25212) |
| 5-Hydroxynoracronycine (CHEBI:69044) is a acridines (CHEBI:22213) |
| Synonym | Source |
|---|---|
| 7H-Pyrano[2,3-c]acridin-7-one, 3,12-dihydro-6,11-dihydroxy-3,3,12-trimethyl- | ChEBI |
| Citations |
|---|