EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O3 |
| Net Charge | 0 |
| Average Mass | 228.247 |
| Monoisotopic Mass | 228.07864 |
| SMILES | CC1(C)C=Cc2c(ccc3ccc(=O)oc23)O1 |
| InChI | InChI=1S/C14H12O3/c1-14(2)8-7-10-11(17-14)5-3-9-4-6-12(15)16-13(9)10/h3-8H,1-2H3 |
| InChIKey | QUVCQYQEIOLHFZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citropsis articulata (IPNI:771824-1) | root (BTO:0001188) | PubMed (21985060) | Previous component: root bark; Cyclohexane and ethyl acetate extract of dried, powdered root bark. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Seselin (CHEBI:69040) has role metabolite (CHEBI:25212) |
| Seselin (CHEBI:69040) is a coumarins (CHEBI:23403) |
| Synonyms | Source |
|---|---|
| 8,8-dimethyl-2H,8H-pyrano[2,3-f]chromen-2-one | ChEBI |
| Amyrolin | ChEBI |
| Seselin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000300 | KNApSAcK |
| C09312 | KEGG COMPOUND |
| HMDB0034257 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:523-59-1 | KEGG COMPOUND |
| CAS:523-59-1 | ChemIDplus |
| Citations |
|---|