EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O10 |
| Net Charge | 0 |
| Average Mass | 424.402 |
| Monoisotopic Mass | 424.13695 |
| SMILES | CC(C)(O)[C@@H]1Cc2cc3ccc(=O)oc3c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2O1 |
| InChI | InChI=1S/C20H24O10/c1-20(2,26)11-6-9-5-8-3-4-12(22)29-16(8)18(17(9)28-11)30-19-15(25)14(24)13(23)10(7-21)27-19/h3-5,10-11,13-15,19,21,23-26H,6-7H2,1-2H3/t10-,11+,13-,14+,15-,19+/m1/s1 |
| InChIKey | JWWFVRMFYKPZNE-VVIWCBLHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citropsis articulata (IPNI:771824-1) | root (BTO:0001188) | PubMed (21985060) | Previous component: root bark; Methanol extract of dried, powdered root bark. |
| Peucedanum praeruptorum (ncbitaxon:312531) | root (BTO:0001188) | PubMed (23477142) | |
| Ruta graveolens (ncbitaxon:37565) | aerial part (BTO:0001658) | DOI (10.1016/j.fitote.2005.02.008) | |
| Atalantia racemosa (ncbitaxon:159026) | aerial part (BTO:0001658) | DOI (10.1021/jf00089a050) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| Application: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rutarin (CHEBI:69039) has role antibacterial agent (CHEBI:33282) |
| rutarin (CHEBI:69039) has role antiplasmodial drug (CHEBI:64915) |
| rutarin (CHEBI:69039) has role plant metabolite (CHEBI:76924) |
| rutarin (CHEBI:69039) is a monosaccharide derivative (CHEBI:63367) |
| rutarin (CHEBI:69039) is a psoralens (CHEBI:26369) |
| rutarin (CHEBI:69039) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (2S)-2-(2-hydroxypropan-2-yl)-7-oxo-2,3-dihydro-7H-furo[3,2-g]chromen-9-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 9-(β-D-glucopyranosyloxy)-2,3-dihydro-2-(1-hydroxy-1-methylethyl)-7H-furo[3,2-g][1]benzopyran-7-one | ChemIDplus |
| (2S)-2-(2-hydroxypropan-2-yl)-7-oxo-2,3-dihydro-7H-furo[3,2-g][1]benzopyran-9-yl β-D-glucopyranoside | IUPAC |
| campesenin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C09309 | KEGG COMPOUND |
| C00002496 | KNApSAcK |
| HMDB0030884 | HMDB |
| FDB002847 | FooDB |
| Registry Numbers | Sources |
|---|---|
| CAS:20320-81-4 | KEGG COMPOUND |
| CAS:20320-81-4 | ChemIDplus |
| Citations |
|---|