EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO11 |
| Net Charge | 0 |
| Average Mass | 483.470 |
| Monoisotopic Mass | 483.17406 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](Oc3cc(=O)n(C)c4ccccc34)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H29NO11/c1-9-15(26)17(28)19(30)21(31-9)34-20-18(29)16(27)13(8-24)33-22(20)32-12-7-14(25)23(2)11-6-4-3-5-10(11)12/h3-7,9,13,15-22,24,26-30H,8H2,1-2H3/t9-,13+,15-,16+,17+,18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | ASAXLUXKTGJUKN-KNEOXYRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citropsis articulata (IPNI:771824-1) | root (BTO:0001188) | PubMed (21985060) | Previous component: root bark; Methanol extract of dried, powdered root bark. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Katimborine (CHEBI:69038) has role metabolite (CHEBI:25212) |
| Katimborine (CHEBI:69038) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| N-methyl-4-O-[alpha-L-rhamnopyranosyl-(1->2)beta-D-glucopyranosyl]-2-quinolone | ChEBI |
| N-methyl-4-O-beta-neohesperidosyl-2-quinolone | ChEBI |
| Citations |
|---|