EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O14 |
| Net Charge | 0 |
| Average Mass | 572.560 |
| Monoisotopic Mass | 572.21051 |
| SMILES | CC1(C)C=Cc2c(ccc(CCC(=O)O)c2O[C@@H]2O[C@H](CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O1 |
| InChI | InChI=1S/C26H36O14/c1-26(2)8-7-12-13(40-26)5-3-11(4-6-16(28)29)23(12)39-25-22(35)20(33)18(31)15(38-25)10-36-24-21(34)19(32)17(30)14(9-27)37-24/h3,5,7-8,14-15,17-22,24-25,27,30-35H,4,6,9-10H2,1-2H3,(H,28,29)/t14-,15-,17-,18-,19+,20+,21-,22-,24-,25+/m1/s1 |
| InChIKey | NQAQCZORTDQVFT-LMYULTQQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citropsis articulata (IPNI:771824-1) | root (BTO:0001188) | PubMed (21985060) | Previous component: root bark; Methanol extract of dried, powdered root bark. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Omubioside (CHEBI:69037) has role metabolite (CHEBI:25212) |
| Omubioside (CHEBI:69037) is a 1-benzopyran (CHEBI:38443) |
| Synonym | Source |
|---|---|
| 8a-(O-beta-gentiobiosyloxy)-7,8-(9,9-dimethylpyrano)hydrocoumaric acid | ChEBI |
| Citations |
|---|