EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15NO5 |
| Net Charge | 0 |
| Average Mass | 301.298 |
| Monoisotopic Mass | 301.09502 |
| SMILES | C[C@@H]1OC2=C(C(=O)C(=N)c3c(O)c(O)cc(C=O)c32)C1(C)C |
| InChI | InChI=1S/C16H15NO5/c1-6-16(2,3)11-14(21)12(17)10-9(15(11)22-6)7(5-18)4-8(19)13(10)20/h4-6,17,19-20H,1-3H3/t6-/m0/s1 |
| InChIKey | LCSBVTRDUJHTLY-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coniothyrium cereale (ncbitaxon:135650) | - | PubMed (21923104) | Endophytic fungus obtained from marine green alga Enteromorpha sp. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-Cereoaldomine (CHEBI:69036) has role metabolite (CHEBI:25212) |
| (-)-Cereoaldomine (CHEBI:69036) is a naphthofuran (CHEBI:39270) |
| Synonym | Source |
|---|---|
| (2S)-6,7-Dihydroxy-5-imino-2,3,3-trimethyl-4-oxo-2,3,4,5-tetrahydronaphtho[1,2-b]furan-9-carbaldehyde | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 26647992 | ChemSpider |
| Citations |
|---|