EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O4 |
| Net Charge | 0 |
| Average Mass | 272.300 |
| Monoisotopic Mass | 272.10486 |
| SMILES | Cc1cc(O)cc2c1C1=C(C(=O)C2=O)C(C)(C)[C@H](C)O1 |
| InChI | InChI=1S/C16H16O4/c1-7-5-9(17)6-10-11(7)15-12(14(19)13(10)18)16(3,4)8(2)20-15/h5-6,8,17H,1-4H3/t8-/m0/s1 |
| InChIKey | MKAVSGZPSXLJKL-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coniothyrium cereale (ncbitaxon:135650) | - | PubMed (21923104) | Endophytic fungus obtained from marine green alga Enteromorpha sp. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-Trypethelone (CHEBI:69035) has role metabolite (CHEBI:25212) |
| (-)-Trypethelone (CHEBI:69035) is a naphthofuran (CHEBI:39270) |
| Synonym | Source |
|---|---|
| (2S)-7-Hydroxy-2,3,3,9-tetramethyl-2,3-dihydronaphtho[1,2-b]furan-4,5-dione | ChEBI |
| Citations |
|---|