EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17NO4 |
| Net Charge | 0 |
| Average Mass | 299.326 |
| Monoisotopic Mass | 299.11576 |
| SMILES | Cc1cc(O)c2c3c(c(O)c4c(c13)O[C@@H](C)C4(C)C)NC2=O |
| InChI | InChI=1S/C17H17NO4/c1-6-5-8(19)10-11-9(6)15-12(17(3,4)7(2)22-15)14(20)13(11)18-16(10)21/h5,7,19-20H,1-4H3,(H,18,21)/t7-/m0/s1 |
| InChIKey | ZEVXHSMDHQZKIS-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coniothyrium cereale (ncbitaxon:135650) | - | PubMed (21923104) | Endophytic fungus obtained from marine green alga Enteromorpha sp. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-Cereolactam (CHEBI:69034) has role metabolite (CHEBI:25212) |
| (-)-Cereolactam (CHEBI:69034) is a naphthofuran (CHEBI:39270) |
| Synonym | Source |
|---|---|
| (8S)-3,6-Dihydroxy-1,7,7,8-tetramethyl-7,8-dihydrobenzo[cd]furo[2,3-f]indol-4(5H)-one | ChEBI |
| Citations |
|---|