EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N3O2 |
| Net Charge | 0 |
| Average Mass | 243.266 |
| Monoisotopic Mass | 243.10078 |
| SMILES | O=C1CNC(=O)[C@H](Cc2cnc3ccccc23)N1 |
| InChI | InChI=1S/C13H13N3O2/c17-12-7-15-13(18)11(16-12)5-8-6-14-10-4-2-1-3-9(8)10/h1-4,6,11,14H,5,7H2,(H,15,18)(H,16,17)/t11-/m0/s1 |
| InChIKey | IFQZEERDQXQTLJ-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces thermophilus (ncbitaxon:28565) | - | PubMed (21967034) | Strain: YM3 4 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclo(glycyltryptophyl) (CHEBI:69031) has role metabolite (CHEBI:25212) |
| Cyclo(glycyltryptophyl) (CHEBI:69031) is a indoles (CHEBI:24828) |
| Synonym | Source |
|---|---|
| (3S)-3-(1H-indol-3-ylmethyl)piperazine-2,5-dione | ChEBI |
| Citations |
|---|