EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N3O2 |
| Net Charge | 0 |
| Average Mass | 311.385 |
| Monoisotopic Mass | 311.16338 |
| SMILES | C=CC(C)(C)c1nc2ccccc2c1C[C@@H]1NC(=O)CNC1=O |
| InChI | InChI=1S/C18H21N3O2/c1-4-18(2,3)16-12(11-7-5-6-8-13(11)21-16)9-14-17(23)19-10-15(22)20-14/h4-8,14,21H,1,9-10H2,2-3H3,(H,19,23)(H,20,22)/t14-/m0/s1 |
| InChIKey | LMFSZBLUNDAQFS-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces thermophilus (ncbitaxon:28565) | - | PubMed (21967034) | Strain: YM3 4 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Talathermophilin E (CHEBI:69030) has role metabolite (CHEBI:25212) |
| Talathermophilin E (CHEBI:69030) is a indoles (CHEBI:24828) |
| Synonym | Source |
|---|---|
| (S)-3-((2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl)methyl)piperazine-2,5-dione | ChEBI |
| Citations |
|---|