EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29N3O3 |
| Net Charge | 0 |
| Average Mass | 407.514 |
| Monoisotopic Mass | 407.22089 |
| SMILES | C=CC(C)(C)c1nc2c3c(ccc2c1C[C@@H]1NC(=O)[C@H](C)NC1=O)OC(C)(C)C=C3 |
| InChI | InChI=1S/C24H29N3O3/c1-7-23(3,4)20-16(12-17-22(29)25-13(2)21(28)26-17)14-8-9-18-15(19(14)27-20)10-11-24(5,6)30-18/h7-11,13,17,27H,1,12H2,2-6H3,(H,25,29)(H,26,28)/t13-,17-/m0/s1 |
| InChIKey | OTUZKRMTUYTBQV-GUYCJALGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces thermophilus (ncbitaxon:28565) | - | PubMed (21967034) | Strain: YM3 4 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Talathermophilin D (CHEBI:69029) has role metabolite (CHEBI:25212) |
| Talathermophilin D (CHEBI:69029) is a 1-benzopyran (CHEBI:38443) |
| Synonym | Source |
|---|---|
| (3S,6S)-3-((1,7-dihydro-7,7-dimethyl-2-(2-methylbut-3-en-2-yl)pyrano-[2,3-g]indol-3-yl)methyl)-6-methylpiperazine-2,5-dione | ChEBI |
| Citations |
|---|