EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N3O3 |
| Net Charge | 0 |
| Average Mass | 393.487 |
| Monoisotopic Mass | 393.20524 |
| SMILES | C=CC(C)(C)c1nc2c3c(ccc2c1C[C@@H]1NC(=O)CNC1=O)OC(C)(C)C=C3 |
| InChI | InChI=1S/C23H27N3O3/c1-6-22(2,3)20-15(11-16-21(28)24-12-18(27)25-16)13-7-8-17-14(19(13)26-20)9-10-23(4,5)29-17/h6-10,16,26H,1,11-12H2,2-5H3,(H,24,28)(H,25,27)/t16-/m0/s1 |
| InChIKey | UAKYLMMIOJWJCB-INIZCTEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces thermophilus (ncbitaxon:28565) | - | PubMed (21967034) | Strain: YM3 4 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Talathermophilin C (CHEBI:69028) has role metabolite (CHEBI:25212) |
| Talathermophilin C (CHEBI:69028) is a 1-benzopyran (CHEBI:38443) |
| Synonym | Source |
|---|---|
| (S)-3-((1,7-dihydro-7,7-dimethyl-2-(2-methylbut-3-en-2-yl)pyrano-[2,3-g]indol-3-yl)methyl)piperazine-2,5-dione | ChEBI |
| Citations |
|---|