EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34O7 |
| Net Charge | 0 |
| Average Mass | 458.551 |
| Monoisotopic Mass | 458.23045 |
| SMILES | [H][C@@]12C[C@]3(C)C(=C)[C@@](C(=O)OC)(C(=O)[C@@](C)(O)C3=O)[C@@]1(C)CC=C(C(=C)C)[C@@]2(C)CCC(=O)O |
| InChI | InChI=1S/C26H34O7/c1-14(2)16-9-12-24(6)17(22(16,4)11-10-18(27)28)13-23(5)15(3)26(24,21(31)33-8)20(30)25(7,32)19(23)29/h9,17,32H,1,3,10-13H2,2,4-8H3,(H,27,28)/t17-,22+,23+,24-,25-,26-/m0/s1 |
| InChIKey | HBZLILHFZMWEGE-QFRJCEMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium rubrum (ncbitaxon:1266769) | - | PubMed (21916432) | Chloroform extract |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cysteine protease inhibitor Any protease inhibitor that restricts the action of a cysteine protease. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| berkeleyone C (CHEBI:69027) has role Penicillium metabolite (CHEBI:76964) |
| berkeleyone C (CHEBI:69027) has role cysteine protease inhibitor (CHEBI:64152) |
| berkeleyone C (CHEBI:69027) is a carbotricyclic compound (CHEBI:38032) |
| berkeleyone C (CHEBI:69027) is a cyclic terpene ketone (CHEBI:36130) |
| berkeleyone C (CHEBI:69027) is a dicarboxylic acid monoester (CHEBI:36244) |
| berkeleyone C (CHEBI:69027) is a meroterpenoid (CHEBI:64419) |
| berkeleyone C (CHEBI:69027) is a methyl ester (CHEBI:25248) |
| berkeleyone C (CHEBI:69027) is a tertiary alcohol (CHEBI:26878) |
| berkeleyone C (CHEBI:69027) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| berkeleyone C (CHEBI:69027) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| rel-3-[(1S,4aS,5R,7S,9R,10aS)-7-hydroxy-5-(methoxycarbonyl)-1,4a,7,9-tetramethyl-11-methylidene-6,8-dioxo-2-(prop-1-en-2-yl)-1,4,4a,5,6,7,8,9,10,10a-decahydro-5,9-methanobenzo[8]annulen-1-yl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21969352 | Reaxys |
| Citations |
|---|