EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O7 |
| Net Charge | 0 |
| Average Mass | 460.567 |
| Monoisotopic Mass | 460.24610 |
| SMILES | [H][C@@]12C[C@]3(C)C(=C)[C@@](C(=O)OC)(C(=O)[C@@](C)(O)C3=O)[C@@]1(C)CC[C@]1([H])C(C)(C)OC(=O)CC[C@@]21C |
| InChI | InChI=1S/C26H36O7/c1-14-23(5)13-16-22(4)11-10-17(27)33-21(2,3)15(22)9-12-24(16,6)26(14,20(30)32-8)19(29)25(7,31)18(23)28/h15-16,31H,1,9-13H2,2-8H3/t15-,16+,22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | XBLDTXYFLHSWHN-RFMSQVAGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium sp. (ncbitaxon:5081) | - | PubMed (21916432) | |
| Penicillium rubrum (ncbitaxon:1266769) | - | PubMed (21916432) | Chloroform extract |
| Roles Classification |
|---|
| Biological Roles: | cysteine protease inhibitor Any protease inhibitor that restricts the action of a cysteine protease. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| preaustinoid A1 (CHEBI:69026) has role Penicillium metabolite (CHEBI:76964) |
| preaustinoid A1 (CHEBI:69026) has role cysteine protease inhibitor (CHEBI:64152) |
| preaustinoid A1 (CHEBI:69026) has role metabolite (CHEBI:25212) |
| preaustinoid A1 (CHEBI:69026) is a carboxylic ester (CHEBI:33308) |
| preaustinoid A1 (CHEBI:69026) is a cyclic terpene ketone (CHEBI:36130) |
| preaustinoid A1 (CHEBI:69026) is a meroterpenoid (CHEBI:64419) |
| preaustinoid A1 (CHEBI:69026) is a organic heterotetracyclic compound (CHEBI:38163) |
| preaustinoid A1 (CHEBI:69026) is a terpene lactone (CHEBI:37668) |
| preaustinoid A1 (CHEBI:69026) is a tertiary alcohol (CHEBI:26878) |
| preaustinoid A1 (CHEBI:69026) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| methyl (5aS,7aS,8R,10S,12R,13aS,13bS)-10-hydroxy-5,5,7a,10,12,13b-hexamethyl-14-methylidene-3,9,11-trioxotetradecahydro-8,12-methanocycloocta[3,4]benzo[1,2-c]oxepine-8(5H)-carboxylate |
| UniProt Name | Source |
|---|---|
| preaustinoid A1 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 8SX | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21969350 | Reaxys |
| Citations |
|---|