EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:69017 - physalin B
| Formula | C28H30O9 |
| Net Charge | 0 |
| Average Mass | 510.539 |
| Monoisotopic Mass | 510.18898 |
| SMILES | [H][C@@]12CC=C3CC=CC(=O)[C@]3(C)[C@@]1([H])CC[C@@]1(O)C(=O)O[C@]3(C)[C@]14O[C@]21OC[C@@]2([H])C(=O)O[C@]3([H])C[C@@]2(C)[C@]4([H])C1=O |
| InChI | InChI=1S/C28H30O9/c1-23-11-18-25(3)28-19(23)20(30)27(37-28,34-12-16(23)21(31)35-18)15-8-7-13-5-4-6-17(29)24(13,2)14(15)9-10-26(28,33)22(32)36-25/h4,6-7,14-16,18-19,33H,5,8-12H2,1-3H3/t14-,15+,16-,18+,19-,23+,24-,25-,26+,27+,28-/m0/s1 |
| InChIKey | HVTFEHJSUSPQBK-IIOAQAAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Physalis angulata (ncbitaxon:113208) | - | PubMed (21954931) |
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| physalin B (CHEBI:69017) has role antimalarial (CHEBI:38068) |
| physalin B (CHEBI:69017) has role antimicrobial agent (CHEBI:33281) |
| physalin B (CHEBI:69017) has role antineoplastic agent (CHEBI:35610) |
| physalin B (CHEBI:69017) is a enone (CHEBI:51689) |
| physalin B (CHEBI:69017) is a lactone (CHEBI:25000) |
| physalin B (CHEBI:69017) is a organic heteroheptacyclic compound (CHEBI:52157) |
| physalin B (CHEBI:69017) is a physalin (CHEBI:76361) |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030128 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1696405 | Reaxys |
| CAS:23133-56-4 | ChemIDplus |
| Citations |
|---|