EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19N5O7 |
| Net Charge | 0 |
| Average Mass | 453.411 |
| Monoisotopic Mass | 453.12845 |
| SMILES | NC(=O)C1=C(N)[C@@H](O)[C@H](O)[C@@H](Nc2cc(-c3nc(=O)c4cccc(O)c4n3)ccc2O)C1=O |
| InChI | InChI=1S/C21H19N5O7/c22-13-12(19(23)32)16(29)15(18(31)17(13)30)24-9-6-7(4-5-10(9)27)20-25-14-8(21(33)26-20)2-1-3-11(14)28/h1-6,15,17-18,24,27-28,30-31H,22H2,(H2,23,32)(H,25,26,33)/t15-,17+,18+/m0/s1 |
| InChIKey | OLYXGVRSMULUQN-CGTJXYLNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseus (ncbitaxon:1911) | - | PubMed (21939253) | Strain: HKI 0545 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Farinamycin (CHEBI:69016) has role metabolite (CHEBI:25212) |
| Farinamycin (CHEBI:69016) is a quinazolines (CHEBI:38530) |
| Citations |
|---|