EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | [H][C@]12CC[C@H](C)c3c(O)c(O)c(C)c(c31)[C@H](C=C(C)C)C[C@@H]2C |
| InChI | InChI=1S/C20H28O2/c1-10(2)8-14-9-12(4)15-7-6-11(3)16-18(15)17(14)13(5)19(21)20(16)22/h8,11-12,14-15,21-22H,6-7,9H2,1-5H3/t11-,12-,14+,15+/m0/s1 |
| InChIKey | QYYIMVMYWAMAAS-DDHJSBNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudopterogorgia elisabethae (ncbitaxon:204377) | - | PubMed (21978379) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pseudopterosin G-J aglycone (CHEBI:69014) has role metabolite (CHEBI:25212) |
| Pseudopterosin G-J aglycone (CHEBI:69014) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| (4S,6S,6aR,9S)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalene-1,2-diol | ChEBI |
| Citations |
|---|