EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O7 |
| Net Charge | 0 |
| Average Mass | 304.254 |
| Monoisotopic Mass | 304.05830 |
| SMILES | O=C1c2c(O)cc(O)cc2OC1(O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H12O7/c16-8-4-11(19)13-12(5-8)22-15(21,14(13)20)6-7-1-2-9(17)10(18)3-7/h1-5,16-19,21H,6H2 |
| InChIKey | VCLACNNZBMRRES-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alphitonia excelsa (ncbitaxon:106658) | xylem (BTO:0001468) | PubMed (21992235) | Previous component: wood; |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alphitonin (CHEBI:69013) has functional parent aurone (CHEBI:47964) |
| alphitonin (CHEBI:69013) has role plant metabolite (CHEBI:76924) |
| alphitonin (CHEBI:69013) is a hydroxyaurone (CHEBI:85970) |
| IUPAC Name |
|---|
| 2-[(3,4-dihydroxyphenyl)methyl]-2,4,6-trihydroxy-1-benzofuran-3(2H)-one |
| Manual Xrefs | Databases |
|---|---|
| LMPK12130073 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:312492 | Reaxys |
| Citations |
|---|