EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O3 |
| Net Charge | 0 |
| Average Mass | 454.695 |
| Monoisotopic Mass | 454.34470 |
| SMILES | [H][C@]1([C@]2([H])OC2(C)C)O[C@@]1([H])[C@H](C)[C@]1([H])CC[C@]2(C)C3=CC[C@@]4([H])C(C)(C)C(=O)CC[C@]4(C)[C@@]3([H])CC[C@@]12C |
| InChI | InChI=1S/C30H46O3/c1-17(23-24(32-23)25-27(4,5)33-25)18-11-15-30(8)20-9-10-21-26(2,3)22(31)13-14-28(21,6)19(20)12-16-29(18,30)7/h9,17-19,21,23-25H,10-16H2,1-8H3/t17-,18+,19+,21+,23+,24+,25+,28-,29+,30-/m1/s1 |
| InChIKey | AQUMMBMETGRMAU-LQJOTZTKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum lenticellatum (IPNI:578201-1) | |||
| twig (BTO:0001411) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. | |
| leaf (BTO:0000713) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cneorin-NP36 (CHEBI:69012) has role plant metabolite (CHEBI:76924) |
| cneorin-NP36 (CHEBI:69012) is a cyclic terpene ketone (CHEBI:36130) |
| cneorin-NP36 (CHEBI:69012) is a epoxide (CHEBI:32955) |
| cneorin-NP36 (CHEBI:69012) is a tirucallane triterpenoid (CHEBI:83211) |
| Synonym | Source |
|---|---|
| (13α,14β,17α,20R,22S,23S,24S)-22,23:24,25-diepoxylanost-7-en-3-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6540956 | Reaxys |
| Citations |
|---|