EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@]([H])([C@@H](C)[C@H](O)C(=O)C=C(C)C)CC[C@]3(C)C1=CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O3/c1-18(2)17-23(31)26(33)19(3)20-11-15-30(8)22-9-10-24-27(4,5)25(32)13-14-28(24,6)21(22)12-16-29(20,30)7/h9,17,19-21,24-26,32-33H,10-16H2,1-8H3/t19-,20+,21+,24+,25+,26+,28-,29+,30-/m1/s1 |
| InChIKey | VLJVSIPTYGANIN-YWCQBWSOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum lenticellatum (IPNI:578201-1) | |||
| twig (BTO:0001411) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. | |
| leaf (BTO:0000713) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β,22S-dihydroxytirucalla-7,24-dien-23-one (CHEBI:69011) has role plant metabolite (CHEBI:76924) |
| 3β,22S-dihydroxytirucalla-7,24-dien-23-one (CHEBI:69011) is a secondary α-hydroxy ketone (CHEBI:2468) |
| 3β,22S-dihydroxytirucalla-7,24-dien-23-one (CHEBI:69011) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| (3β,13α,14β,17α,20R,22S)-3,22-dihydroxylanosta-7,24-dien-23-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8660827 | Reaxys |
| Citations |
|---|