EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O3 |
| Net Charge | 0 |
| Average Mass | 400.603 |
| Monoisotopic Mass | 400.29775 |
| SMILES | [H][C@]1([C@]2([H])CC[C@]3(C)C4=CC[C@@]5([H])C(C)(C)[C@H](O)CC[C@]5(C)[C@@]4([H])CC[C@@]23C)COC(=O)C1 |
| InChI | InChI=1S/C26H40O3/c1-23(2)20-7-6-19-18(24(20,3)11-10-21(23)27)9-13-25(4)17(8-12-26(19,25)5)16-14-22(28)29-15-16/h6,16-18,20-21,27H,7-15H2,1-5H3/t16-,17+,18+,20+,21-,24-,25+,26-/m1/s1 |
| InChIKey | JUXMUKOXQMUUKD-NGKMTSHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum lenticellatum (IPNI:578201-1) | |||
| twig (BTO:0001411) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. | |
| leaf (BTO:0000713) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-24,25,26,27-tetranortirucall-7-ene-23(21)-lactone (CHEBI:69010) has role metabolite (CHEBI:25212) |
| 3-hydroxy-24,25,26,27-tetranortirucall-7-ene-23(21)-lactone (CHEBI:69010) has role plant metabolite (CHEBI:76924) |
| 3-hydroxy-24,25,26,27-tetranortirucall-7-ene-23(21)-lactone (CHEBI:69010) is a butan-4-olide (CHEBI:22950) |
| 3-hydroxy-24,25,26,27-tetranortirucall-7-ene-23(21)-lactone (CHEBI:69010) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3α,5α,13α,17α,20S)-3-hydroxy-4,4,14-trimethylcard-7-enolide |
| Synonym | Source |
|---|---|
| 3α-hydroxy-24,25,26,27-tetranortirucall-7-ene-23(21)-lactone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 26636633 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21456890 | Reaxys |
| Citations |
|---|