EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O3 |
| Net Charge | 0 |
| Average Mass | 400.603 |
| Monoisotopic Mass | 400.29775 |
| SMILES | [H][C@]1([C@]2([H])CC[C@]3(C)C4=CC[C@@]5([H])C(C)(C)[C@H](O)CC[C@]5(C)[C@@]4([H])CC[C@@]23C)COC(=O)C1 |
| InChI | InChI=1S/C26H40O3/c1-23(2)20-7-6-19-18(24(20,3)11-10-21(23)27)9-13-25(4)17(8-12-26(19,25)5)16-14-22(28)29-15-16/h6,16-18,20-21,27H,7-15H2,1-5H3/t16-,17+,18+,20+,21-,24-,25+,26-/m1/s1 |
| InChIKey | JUXMUKOXQMUUKD-NGKMTSHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum lenticellatum (IPNI:578201-1) | |||
| leaf (BTO:0000713) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. | |
| twig (BTO:0001411) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-24,25,26,27-tetranortirucall-7-ene-23(21)-lactone (CHEBI:69010) has role metabolite (CHEBI:25212) |
| 3-hydroxy-24,25,26,27-tetranortirucall-7-ene-23(21)-lactone (CHEBI:69010) has role plant metabolite (CHEBI:76924) |
| 3-hydroxy-24,25,26,27-tetranortirucall-7-ene-23(21)-lactone (CHEBI:69010) is a butan-4-olide (CHEBI:22950) |
| 3-hydroxy-24,25,26,27-tetranortirucall-7-ene-23(21)-lactone (CHEBI:69010) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3α,5α,13α,17α,20S)-3-hydroxy-4,4,14-trimethylcard-7-enolide |
| Synonym | Source |
|---|---|
| 3α-hydroxy-24,25,26,27-tetranortirucall-7-ene-23(21)-lactone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 26636633 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21456890 | Reaxys |
| Citations |
|---|