EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O5 |
| Net Charge | 0 |
| Average Mass | 484.677 |
| Monoisotopic Mass | 484.31887 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@]([H])(C(CC(=O)[C@@H]4OC4(C)C)C(=O)O)CC[C@]3(C)C1=CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H44O5/c1-26(2)22-9-8-20-19(28(22,5)13-12-23(26)32)11-15-29(6)18(10-14-30(20,29)7)17(25(33)34)16-21(31)24-27(3,4)35-24/h8,17-19,22,24H,9-16H2,1-7H3,(H,33,34)/t17?,18-,19-,22-,24-,28+,29-,30+/m0/s1 |
| InChIKey | AMRCICCVHDCFMF-QEUZUSFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum lenticellatum (IPNI:578201-1) | |||
| twig (BTO:0001411) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. | |
| leaf (BTO:0000713) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dysolenticin H (CHEBI:69005) has role plant metabolite (CHEBI:76924) |
| dysolenticin H (CHEBI:69005) is a cyclic terpene ketone (CHEBI:36130) |
| dysolenticin H (CHEBI:69005) is a epoxide (CHEBI:32955) |
| dysolenticin H (CHEBI:69005) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| (13α,14β,17α,20ξ,24R)-21-hydroxy-21,23-dioxo-24,25-epoxylanost-7-en-3-one |
| Manual Xrefs | Databases |
|---|---|
| 26616751 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22011337 | Reaxys |
| Citations |
|---|