EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O2 |
| Net Charge | 0 |
| Average Mass | 356.550 |
| Monoisotopic Mass | 356.27153 |
| SMILES | [H][C@@]1(C(C)=O)CC[C@]2(C)C3=CC[C@@]4([H])C(C)(C)C(=O)CC[C@]4(C)[C@@]3([H])CC[C@@]12C |
| InChI | InChI=1S/C24H36O2/c1-15(25)16-9-13-24(6)18-7-8-19-21(2,3)20(26)11-12-22(19,4)17(18)10-14-23(16,24)5/h7,16-17,19H,8-14H2,1-6H3/t16-,17-,19-,22+,23-,24+/m0/s1 |
| InChIKey | ZGWAMLWWZPWUEI-DYIMBGGFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum lenticellatum (IPNI:578201-1) | |||
| twig (BTO:0001411) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. | |
| leaf (BTO:0000713) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dysolenticin G (CHEBI:69003) has role metabolite (CHEBI:25212) |
| dysolenticin G (CHEBI:69003) has role plant metabolite (CHEBI:76924) |
| dysolenticin G (CHEBI:69003) is a cyclic terpene ketone (CHEBI:36130) |
| dysolenticin G (CHEBI:69003) is a methyl ketone (CHEBI:51867) |
| dysolenticin G (CHEBI:69003) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| rel-(5α,13α,14β,17α)-4,4,14-trimethylpregn-7-ene-3,20-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21148043 | Reaxys |
| Citations |
|---|