EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H52O4 |
| Net Charge | 0 |
| Average Mass | 500.764 |
| Monoisotopic Mass | 500.38656 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@]([H])(C4CO[C@@](OCC)([C@]5([H])OC5(C)C)C4)CC[C@]3(C)C1=CC[C@@]1([H])C(C)(C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C32H52O4/c1-9-34-32(26-28(4,5)36-26)18-20(19-35-32)21-12-16-31(8)23-10-11-24-27(2,3)25(33)14-15-29(24,6)22(23)13-17-30(21,31)7/h10,20-22,24-26,33H,9,11-19H2,1-8H3/t20?,21-,22-,24-,25+,26+,29+,30-,31+,32+/m0/s1 |
| InChIKey | ODYWIKPNSKWRFZ-SZDISNEQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum lenticellatum (IPNI:578201-1) | |||
| twig (BTO:0001411) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. | |
| leaf (BTO:0000713) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dysolenticin F (CHEBI:69002) has role plant metabolite (CHEBI:76924) |
| dysolenticin F (CHEBI:69002) is a epoxide (CHEBI:32955) |
| dysolenticin F (CHEBI:69002) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3α,13α,14β,17α,20ξ,23R,24S)-23-ethoxy-21,23:24,25-diepoxylanost-7-en-3-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22011338 | Reaxys |
| Citations |
|---|