EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@]([H])(C4COC(O)(C(=O)C(C)C)C4)CC[C@]3(C)C1=CC[C@@]1([H])C(C)(C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-18(2)25(32)30(33)16-19(17-34-30)20-10-14-29(7)22-8-9-23-26(3,4)24(31)12-13-27(23,5)21(22)11-15-28(20,29)6/h8,18-21,23-24,31,33H,9-17H2,1-7H3/t19?,20-,21-,23-,24+,27+,28-,29+,30?/m0/s1 |
| InChIKey | UTRFMZZTJWAJPP-RADKDSRJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum lenticellatum (IPNI:578201-1) | |||
| leaf (BTO:0000713) | PubMed (21954912) | Compound is an epimeric mixture. 95% Ethanolic extract of air-dried, powdered leaves and twigs. | |
| twig (BTO:0001411) | PubMed (21954912) | Compound is an epimeric mixture. 95% Ethanolic extract of air-dried, powdered leaves and twigs. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dysolenticin E (CHEBI:69001) has role plant metabolite (CHEBI:76924) |
| dysolenticin E (CHEBI:69001) is a cyclic hemiketal (CHEBI:59780) |
| dysolenticin E (CHEBI:69001) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| (3α,13α,14β,17α,20ξ)-3,23-dihydroxy-21,23-epoxylanost-7-en-24-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22011333 | Reaxys |
| Citations |
|---|