EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38O5 |
| Net Charge | 0 |
| Average Mass | 442.596 |
| Monoisotopic Mass | 442.27192 |
| SMILES | [H][C@@]1(C2=CC(O)(CO)OC2=O)CC[C@]2(C)C3=CC[C@@]4([H])C(C)(C)C(=O)CC[C@]4(C)[C@@]3([H])CC[C@@]12C |
| InChI | InChI=1S/C27H38O5/c1-23(2)20-7-6-19-18(24(20,3)11-10-21(23)29)9-13-25(4)17(8-12-26(19,25)5)16-14-27(31,15-28)32-22(16)30/h6,14,17-18,20,28,31H,7-13,15H2,1-5H3/t17-,18-,20-,24+,25-,26+,27?/m0/s1 |
| InChIKey | DKUCZRZGAXYSEA-LRJKLRJMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum lenticellatum (IPNI:578201-1) | |||
| leaf (BTO:0000713) | PubMed (21954912) | Compound is an epimeric mixture. 95% Ethanolic extract of air-dried, powdered leaves and twigs. | |
| twig (BTO:0001411) | PubMed (21954912) | Compound is an epimeric mixture. 95% Ethanolic extract of air-dried, powdered leaves and twigs. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dysolenticin C (CHEBI:68999) has role metabolite (CHEBI:25212) |
| dysolenticin C (CHEBI:68999) has role plant metabolite (CHEBI:76924) |
| dysolenticin C (CHEBI:68999) is a butenolide (CHEBI:50523) |
| dysolenticin C (CHEBI:68999) is a cyclic terpene ketone (CHEBI:36130) |
| dysolenticin C (CHEBI:68999) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| rel-(5α,13α,14β,17α)-23,24-dihydroxy-4,4,14-trimethyl-21,23-epoxychola-7,20(22)-diene-3,21-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22011330 | Reaxys |
| Citations |
|---|