EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O3 |
| Net Charge | 0 |
| Average Mass | 450.663 |
| Monoisotopic Mass | 450.31340 |
| SMILES | [H][C@@]1(C=C(C)C)C=C([C@]2([H])CC[C@]3(C)C4=CC[C@@]5([H])C(C)(C)C(=O)CC[C@]5(C)[C@@]4([H])CC[C@@]23C)C(=O)O1 |
| InChI | InChI=1S/C30H42O3/c1-18(2)16-19-17-20(26(32)33-19)21-10-14-30(7)23-8-9-24-27(3,4)25(31)12-13-28(24,5)22(23)11-15-29(21,30)6/h8,16-17,19,21-22,24H,9-15H2,1-7H3/t19-,21+,22+,24+,28-,29+,30-/m1/s1 |
| InChIKey | RPPAVMFODBKIDO-HALKBXBMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum lenticellatum (IPNI:578201-1) | |||
| twig (BTO:0001411) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs | |
| leaf (BTO:0000713) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dysolenticin B (CHEBI:68998) has role plant metabolite (CHEBI:76924) |
| dysolenticin B (CHEBI:68998) is a butenolide (CHEBI:50523) |
| dysolenticin B (CHEBI:68998) is a cyclic terpene ketone (CHEBI:36130) |
| dysolenticin B (CHEBI:68998) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| rel-(13α,14β,17α,23R)-21,23-epoxylanosta-7,20(22),24-triene-3,21-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22011332 | Reaxys |
| Citations |
|---|