EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N |
| Net Charge | 0 |
| Average Mass | 147.221 |
| Monoisotopic Mass | 147.10480 |
| SMILES | CC/C(C)=C\c1cccnc1 |
| InChI | InChI=1S/C10H13N/c1-3-9(2)7-10-5-4-6-11-8-10/h4-8H,3H2,1-2H3/b9-7- |
| InChIKey | YXDDELNBTVXEIH-CLFYSBASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stenus similis (ncbitaxon:346855) | gland (BTO:0000522) | PubMed (21936550) | Methanolic extract of pygidial gland |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-3-(2-methyl-1-butenyl)pyridine (CHEBI:68996) has role metabolite (CHEBI:25212) |
| (Z)-3-(2-methyl-1-butenyl)pyridine (CHEBI:68996) is a pyridines (CHEBI:26421) |
| Citations |
|---|