EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21NO4 |
| Net Charge | 0 |
| Average Mass | 339.391 |
| Monoisotopic Mass | 339.14706 |
| SMILES | [H][C@]12Cc3cc4c(cc3-c3c(OC)c(OC)cc(c31)CCN2C)OCO4 |
| InChI | InChI=1S/C20H21NO4/c1-21-5-4-11-7-17(22-2)20(23-3)19-13-9-16-15(24-10-25-16)8-12(13)6-14(21)18(11)19/h7-9,14H,4-6,10H2,1-3H3/t14-/m0/s1 |
| InChIKey | WSVWKHTVFGTTKJ-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Corydalis cava (IPNI:672129-1) | - | PubMed (22029392) | |
| Nandina domestica (ncbitaxon:41776) | - | PubMed (22029392) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nantenine (CHEBI:68992) has role metabolite (CHEBI:25212) |
| nantenine (CHEBI:68992) is a oxoaporphine alkaloid (CHEBI:132998) |
| Synonyms | Source |
|---|---|
| o-Methyldomesticine | ChEBI |
| Domestine | ChEBI |
| (6aS)-1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-benzo[de][1,3]benzodioxolo[5,6-g]quinoline | ChEBI |
| 6a-alpha-Aporphine, 1,2-dimethoxy-9,10-(methylenedioxy)- | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:2565-01-7 | ChemIDplus |
| Citations |
|---|