EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6899 - metoclopramide hydrochloride
| Formula | C14H22ClN3O2.H2O.HCl |
| Net Charge | 0 |
| Average Mass | 354.278 |
| Monoisotopic Mass | 353.12730 |
| SMILES | CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC.Cl.O |
| InChI | InChI=1S/C14H22ClN3O2.ClH.H2O/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3;;/h8-9H,4-7,16H2,1-3H3,(H,17,19);1H;1H2 |
| InChIKey | KJBLQGHJOCAOJP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metoclopramide hydrochloride (CHEBI:6899) has part metoclopramide(1+) (CHEBI:61170) |
| metoclopramide hydrochloride (CHEBI:6899) has role antiemetic (CHEBI:50919) |
| metoclopramide hydrochloride (CHEBI:6899) has role dopaminergic antagonist (CHEBI:48561) |
| metoclopramide hydrochloride (CHEBI:6899) has role gastrointestinal drug (CHEBI:55324) |
| metoclopramide hydrochloride (CHEBI:6899) is a hydrate (CHEBI:35505) |
| metoclopramide hydrochloride (CHEBI:6899) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| metoclopramide dihydrochloride monohydrate (CHEBI:60906) has part metoclopramide hydrochloride (CHEBI:6899) |
| IUPAC Names |
|---|
| 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride—water (1/1) |
| 2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-N,N-diethylethanaminium chloride—water (1/1) |
| Synonyms | Source |
|---|---|
| 4-amino-5-chloro-N-(2-(diethylamino)ethyl)-o-anisamide monohydrochloride monohydrate | ChemIDplus |
| Metoclopramide HCl H2O | ChEBI |
| metoclopramide hydrochloride monohydrate | KEGG DRUG |
| Brand Names | Source |
|---|---|
| Metramid | DrugBank |
| Pramiel | DrugBank |
| Cerucal | DrugBank |
| Metocobil | DrugBank |
| Parmid | DrugBank |
| Maxolon | DrugBank |