EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H31NO9 |
| Net Charge | 0 |
| Average Mass | 549.576 |
| Monoisotopic Mass | 549.19988 |
| SMILES | CCCC[C@@H]1C(=O)OC2c3cc(C)cc(O)c3C3=C(C(=O)c4c(O[C@H]5C[C@@H](O)[C@@H](O)[C@H](C)O5)cccc4C3=O)N21 |
| InChI | InChI=1S/C30H31NO9/c1-4-5-8-17-30(37)40-29-16-10-13(2)11-18(32)22(16)24-25(31(17)29)28(36)23-15(27(24)35)7-6-9-20(23)39-21-12-19(33)26(34)14(3)38-21/h6-7,9-11,14,17,19,21,26,29,32-34H,4-5,8,12H2,1-3H3/t14-,17+,19+,21-,26-,29?/m0/s1 |
| InChIKey | YMBCQAMVBMTDAL-BEJQPSFTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces venezuelae ISP5230 (ncbitaxon:953739) | - | PubMed (22050382) | compound is 1.65:1(3aS:3aR) diastereomeric mixture Strain: VS1099 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Jadomycin DNL (CHEBI:68985) has role metabolite (CHEBI:25212) |
| Jadomycin DNL (CHEBI:68985) is a isoquinolines (CHEBI:24922) |
| Citations |
|---|